C22H28F2O3 — CID 11257446
[(8R,9S,13S,14S,17S)-2-(1,1-difluoroethyl)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 11257446) has the molecular formula C22H28F2O3 and a molecular weight of 378.46 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-2-(1,1-difluoroethyl)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,17S)-2-(1,1-difluoroethyl)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 11257446 |
| Molecular Formula | C22H28F2O3 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-2-(1,1-difluoroethyl)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(cc1C(C)(F)F)[C@H]1CC[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C22H28F2O3/c1-12(25)27-19-10-13-4-5-15-14(16(13)11-18(19)22(3,23)24)8-9-21(2)17(15)6-7-20(21)26/h10-11,14-15,17,20,26H,4-9H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1 |
| InChIKey | NFCANMONBXLCCY-PVHGPHFFSA-N |
| XLogP | 4.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|