C24H32O9 — CID 101074460
[(8R,9S,13S,14S,17S)-2,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate (PubChem CID 101074460) has the molecular formula C24H32O9 and a molecular weight of 464.51 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-2,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate.
| Compound Name | [(8R,9S,13S,14S,17S)-2,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 101074460 |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-2,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| SMILES | C[C@]12CC[C@@H]3c4cc(O)c(OC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C24H32O9/c1-24-7-6-12-13(15(24)4-5-19(24)28)3-2-11-8-18(16(26)9-14(11)12)33-23(32)22(31)21(30)20(29)17(27)10-25/h8-10,12-13,15,17,19-22,26-31H,2-7H2,1H3/t12-,13+,15-,17-,19-,20+,21-,22-,24-/m0/s1 |
| InChIKey | PEFLVYMZXGCZJY-LMDDYKMUSA-N |
| XLogP | 0.16 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|