C22H27BrO4 — CID 124773035
[(8R,9R,13S,14R,17R)-3-acetyloxy-2-bromo-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 124773035) has the molecular formula C22H27BrO4 and a molecular weight of 435.36 g/mol. Its IUPAC name is [(8R,9R,13S,14R,17R)-3-acetyloxy-2-bromo-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9R,13S,14R,17R)-3-acetyloxy-2-bromo-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 124773035 |
| Molecular Formula | C22H27BrO4 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | [(8R,9R,13S,14R,17R)-3-acetyloxy-2-bromo-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(cc1Br)[C@@H]1CC[C@@]3(C)[C@H](CC[C@H]3OC(C)=O)[C@@H]1CC2 |
| InChI | InChI=1S/C22H27BrO4/c1-12(24)26-20-10-14-4-5-16-15(17(14)11-19(20)23)8-9-22(3)18(16)6-7-21(22)27-13(2)25/h10-11,15-16,18,21H,4-9H2,1-3H3/t15-,16-,18-,21-,22+/m1/s1 |
| InChIKey | SJEALCGIPRMQHF-SCLAEEFJSA-N |
| XLogP | 5.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|