C28H36F2 — CID 142613745
3-[(Z)-3,4-difluoro-2,5-dimethylidenehept-3-enyl]-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 142613745) has the molecular formula C28H36F2 and a molecular weight of 410.59 g/mol. Its IUPAC name is 3-[(Z)-3,4-difluoro-2,5-dimethylidenehept-3-enyl]-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | 3-[(Z)-3,4-difluoro-2,5-dimethylidenehept-3-enyl]-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 142613745 |
| Molecular Formula | C28H36F2 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 3-[(Z)-3,4-difluoro-2,5-dimethylidenehept-3-enyl]-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C=C(CC)/C(F)=C(/F)C(=C)Cc1ccc2c(c1)CCC1C2CCC2(C)C(C)CCC12 |
| InChI | InChI=1S/C28H36F2/c1-6-17(2)26(29)27(30)18(3)15-20-8-10-22-21(16-20)9-11-24-23(22)13-14-28(5)19(4)7-12-25(24)28/h8,10,16,19,23-25H,2-3,6-7,9,11-15H2,1,4-5H3/b27-26- |
| InChIKey | YBXQAHCMXXNEKX-RQZHXJHFSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|