C25H37NO — CID 166889459
3-[[(13R)-17-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-3-methylbut-1-en-2-amine (PubChem CID 166889459) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is 3-[[(13R)-17-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-3-methylbut-1-en-2-amine.
| Compound Name | 3-[[(13R)-17-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-3-methylbut-1-en-2-amine |
|---|---|
| PubChem CID | 166889459 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | 3-[[(13R)-17-ethyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-3-methylbut-1-en-2-amine |
| SMILES | C=C(N)C(C)(C)Oc1ccc2c(c1)CCC1C2CC[C@]2(C)C(CC)CCC12 |
| InChI | InChI=1S/C25H37NO/c1-6-18-8-12-23-22-10-7-17-15-19(27-24(3,4)16(2)26)9-11-20(17)21(22)13-14-25(18,23)5/h9,11,15,18,21-23H,2,6-8,10,12-14,26H2,1,3-5H3/t18?,21?,22?,23?,25-/m1/s1 |
| InChIKey | HFDVUDVRUMMCAZ-ULPMDJMCSA-N |
| XLogP | 6.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |