C21H26O2 — CID 140980442
2-[(8S,9S,13S,14S)-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]acetic acid (PubChem CID 140980442) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-[(8S,9S,13S,14S)-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]acetic acid.
| Compound Name | 2-[(8S,9S,13S,14S)-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]acetic acid |
|---|---|
| PubChem CID | 140980442 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-[(8S,9S,13S,14S)-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]acetic acid |
| SMILES | C=C1CC[C@H]2[C@@H]3CCc4cc(CC(=O)O)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H26O2/c1-13-3-8-19-18-7-5-15-11-14(12-20(22)23)4-6-16(15)17(18)9-10-21(13,19)2/h4,6,11,17-19H,1,3,5,7-10,12H2,2H3,(H,22,23)/t17-,18-,19+,21-/m1/s1 |
| InChIKey | WEXYJEYYTDLUIV-WERVVEIQSA-N |
| XLogP | 4.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|