C23H38 — CID 142945041
3,13-dimethyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene;methane (PubChem CID 142945041) has the molecular formula C23H38 and a molecular weight of 314.56 g/mol. Its IUPAC name is 3,13-dimethyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene;methane.
| Compound Name | 3,13-dimethyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene;methane |
|---|---|
| PubChem CID | 142945041 |
| Molecular Formula | C23H38 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | 3,13-dimethyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene;methane |
| SMILES | C.C.C.C=C1CCC2C3CCc4cc(C)ccc4C3CCC12C |
| InChI | InChI=1S/C20H26.3CH4/c1-13-4-7-16-15(12-13)6-8-18-17(16)10-11-20(3)14(2)5-9-19(18)20;;;/h4,7,12,17-19H,2,5-6,8-11H2,1,3H3;3*1H4 |
| InChIKey | PFXPCJADTLOWPW-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|