C22H34 — CID 142839005
1,2,7-trimethyl-2-(3-methylbutan-2-yl)-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene (PubChem CID 142839005) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is 1,2,7-trimethyl-2-(3-methylbutan-2-yl)-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene.
| Compound Name | 1,2,7-trimethyl-2-(3-methylbutan-2-yl)-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 142839005 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 1,2,7-trimethyl-2-(3-methylbutan-2-yl)-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene |
| SMILES | Cc1ccc2c(c1)CCC1C2CCC(C)(C(C)C(C)C)C1C |
| InChI | InChI=1S/C22H34/c1-14(2)16(4)22(6)12-11-21-19(17(22)5)10-8-18-13-15(3)7-9-20(18)21/h7,9,13-14,16-17,19,21H,8,10-12H2,1-6H3 |
| InChIKey | CEQHQQRKZBLMNP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |