C20H28O3 — CID 161024241
(13S,16S,17R)-17-methoxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15,16-diol (PubChem CID 161024241) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (13S,16S,17R)-17-methoxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15,16-diol.
| Compound Name | (13S,16S,17R)-17-methoxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15,16-diol |
|---|---|
| PubChem CID | 161024241 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (13S,16S,17R)-17-methoxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-15,16-diol |
| SMILES | CO[C@H]1[C@@H](O)C(O)C2C3CCc4cc(C)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C20H28O3/c1-11-4-6-13-12(10-11)5-7-15-14(13)8-9-20(2)16(15)17(21)18(22)19(20)23-3/h4,6,10,14-19,21-22H,5,7-9H2,1-3H3/t14?,15?,16?,17?,18-,19-,20-/m0/s1 |
| InChIKey | SHSBATAEXUOZCH-YAQFZYRKSA-N |
| XLogP | 2.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |