C19H29NO2 — CID 11771128
(4bS,7S,8S,8aR)-8-(2-aminoethyl)-7-[(1R)-1-hydroxyethyl]-7-methyl-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol (PubChem CID 11771128) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (4bS,7S,8S,8aR)-8-(2-aminoethyl)-7-[(1R)-1-hydroxyethyl]-7-methyl-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol.
| Compound Name | (4bS,7S,8S,8aR)-8-(2-aminoethyl)-7-[(1R)-1-hydroxyethyl]-7-methyl-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol |
|---|---|
| PubChem CID | 11771128 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (4bS,7S,8S,8aR)-8-(2-aminoethyl)-7-[(1R)-1-hydroxyethyl]-7-methyl-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol |
| SMILES | C[C@@H](O)[C@@]1(C)CC[C@@H]2c3ccc(O)cc3CC[C@H]2[C@@H]1CCN |
| InChI | InChI=1S/C19H29NO2/c1-12(21)19(2)9-7-16-15-6-4-14(22)11-13(15)3-5-17(16)18(19)8-10-20/h4,6,11-12,16-18,21-22H,3,5,7-10,20H2,1-2H3/t12-,16-,17-,18+,19-/m1/s1 |
| InChIKey | LLGVULJZFPGDNO-BGKSWFOJSA-N |
| XLogP | 3.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |