C19H23NO3 — CID 71271315
(8R,9S,13S,14R,15S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide (PubChem CID 71271315) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (8R,9S,13S,14R,15S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide.
| Compound Name | (8R,9S,13S,14R,15S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide |
|---|---|
| PubChem CID | 71271315 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (8R,9S,13S,14R,15S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1[C@@H](C(N)=O)CC2=O |
| InChI | InChI=1S/C19H23NO3/c1-19-7-6-13-12-5-3-11(21)8-10(12)2-4-14(13)17(19)15(18(20)23)9-16(19)22/h3,5,8,13-15,17,21H,2,4,6-7,9H2,1H3,(H2,20,23)/t13-,14-,15+,17-,19-/m1/s1 |
| InChIKey | NADSLOJVJIMGRG-VVRDOHNDSA-N |
| XLogP | 2.53 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |