C22H28BrNO3 — CID 71529418
(8R,9S,13S,14R,15S)-3-(3-bromopropoxy)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide (PubChem CID 71529418) has the molecular formula C22H28BrNO3 and a molecular weight of 434.37 g/mol. Its IUPAC name is (8R,9S,13S,14R,15S)-3-(3-bromopropoxy)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide.
| Compound Name | (8R,9S,13S,14R,15S)-3-(3-bromopropoxy)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide |
|---|---|
| PubChem CID | 71529418 |
| Molecular Formula | C22H28BrNO3 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (8R,9S,13S,14R,15S)-3-(3-bromopropoxy)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCBr)cc4CC[C@H]3[C@@H]1[C@@H](C(N)=O)CC2=O |
| InChI | InChI=1S/C22H28BrNO3/c1-22-8-7-16-15-6-4-14(27-10-2-9-23)11-13(15)3-5-17(16)20(22)18(21(24)26)12-19(22)25/h4,6,11,16-18,20H,2-3,5,7-10,12H2,1H3,(H2,24,26)/t16-,17-,18+,20-,22-/m1/s1 |
| InChIKey | UTQNRMGXBHEQMB-FHZCGSGISA-N |
| XLogP | 3.99 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|