C29H41FN2O3 — CID 71276381
(8R,9S,13S,14R,15S)-N-ethyl-3-[3-(4-fluoropiperidin-1-yl)propoxy]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide (PubChem CID 71276381) has the molecular formula C29H41FN2O3 and a molecular weight of 484.66 g/mol. Its IUPAC name is (8R,9S,13S,14R,15S)-N-ethyl-3-[3-(4-fluoropiperidin-1-yl)propoxy]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide.
| Compound Name | (8R,9S,13S,14R,15S)-N-ethyl-3-[3-(4-fluoropiperidin-1-yl)propoxy]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide |
|---|---|
| PubChem CID | 71276381 |
| Molecular Formula | C29H41FN2O3 |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | (8R,9S,13S,14R,15S)-N-ethyl-3-[3-(4-fluoropiperidin-1-yl)propoxy]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide |
| SMILES | CCNC(=O)[C@H]1CC(=O)[C@@]2(C)CC[C@@H]3c4ccc(OCCCN5CCC(F)CC5)cc4CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C29H41FN2O3/c1-3-31-28(34)25-18-26(33)29(2)12-9-23-22-8-6-21(17-19(22)5-7-24(23)27(25)29)35-16-4-13-32-14-10-20(30)11-15-32/h6,8,17,20,23-25,27H,3-5,7,9-16,18H2,1-2H3,(H,31,34)/t23-,24-,25+,27-,29-/m1/s1 |
| InChIKey | STCAZOUTSRLMGA-YFGKGCBZSA-N |
| XLogP | 4.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|