C31H46N2O3 — CID 71528929
[(8R,9S,13S,14R,15S,17S)-17-hydroxy-13-methyl-3-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-pyrrolidin-1-ylmethanone (PubChem CID 71528929) has the molecular formula C31H46N2O3 and a molecular weight of 494.72 g/mol. Its IUPAC name is [(8R,9S,13S,14R,15S,17S)-17-hydroxy-13-methyl-3-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(8R,9S,13S,14R,15S,17S)-17-hydroxy-13-methyl-3-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 71528929 |
| Molecular Formula | C31H46N2O3 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.35 |
| IUPAC Name | [(8R,9S,13S,14R,15S,17S)-17-hydroxy-13-methyl-3-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-pyrrolidin-1-ylmethanone |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc2c(c1)CC[C@H]1[C@@H]3[C@@H](C(=O)N4CCCC4)C[C@H](O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C31H46N2O3/c1-21-7-5-16-32(21)17-6-18-36-23-9-11-24-22(19-23)8-10-26-25(24)12-13-31(2)28(34)20-27(29(26)31)30(35)33-14-3-4-15-33/h9,11,19,21,25-29,34H,3-8,10,12-18,20H2,1-2H3/t21-,25-,26-,27+,28+,29-,31-/m1/s1 |
| InChIKey | JXYXNOYCHXQKKR-KBLDRHFISA-N |
| XLogP | 5.01 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|