C31H48N2O2 — CID 177381092
1-[(4aS,4bR,10bS,12aS)-12a-methyl-8-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 177381092) has the molecular formula C31H48N2O2 and a molecular weight of 480.74 g/mol. Its IUPAC name is 1-[(4aS,4bR,10bS,12aS)-12a-methyl-8-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(4aS,4bR,10bS,12aS)-12a-methyl-8-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 177381092 |
| Molecular Formula | C31H48N2O2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.37 |
| IUPAC Name | 1-[(4aS,4bR,10bS,12aS)-12a-methyl-8-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CCCN2C(=O)C(C)(C)C |
| InChI | InChI=1S/C31H48N2O2/c1-22-9-6-17-32(22)18-8-20-35-24-12-14-25-23(21-24)11-13-27-26(25)15-16-31(5)28(27)10-7-19-33(31)29(34)30(2,3)4/h12,14,21-22,26-28H,6-11,13,15-20H2,1-5H3/t22-,26-,27-,28+,31+/m1/s1 |
| InChIKey | AOPVHRDNNHKHGD-CVCOIASMSA-N |
| XLogP | 6.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|