C17H24O — CID 58697889
(8S)-7,7,8-trimethyl-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol (PubChem CID 58697889) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (8S)-7,7,8-trimethyl-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol.
| Compound Name | (8S)-7,7,8-trimethyl-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol |
|---|---|
| PubChem CID | 58697889 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (8S)-7,7,8-trimethyl-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol |
| SMILES | C[C@H]1C2CCc3cc(O)ccc3C2CCC1(C)C |
| InChI | InChI=1S/C17H24O/c1-11-14-6-4-12-10-13(18)5-7-15(12)16(14)8-9-17(11,2)3/h5,7,10-11,14,16,18H,4,6,8-9H2,1-3H3/t11-,14?,16?/m0/s1 |
| InChIKey | HGVCQKBKIABZPO-WJFWJRBTSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |