C30H40O5 — CID 142945020
(E,1S)-1-[(2S)-7-methoxy-1,2-dimethyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]-2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol (PubChem CID 142945020) has the molecular formula C30H40O5 and a molecular weight of 480.65 g/mol. Its IUPAC name is (E,1S)-1-[(2S)-7-methoxy-1,2-dimethyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]-2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol.
| Compound Name | (E,1S)-1-[(2S)-7-methoxy-1,2-dimethyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]-2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 142945020 |
| Molecular Formula | C30H40O5 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (E,1S)-1-[(2S)-7-methoxy-1,2-dimethyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]-2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-ol |
| SMILES | COc1ccc2c(c1)CCC1C2CC[C@](C)([C@@H](O)/C(C)=C/c2cc(OC)c(OC)c(OC)c2)C1C |
| InChI | InChI=1S/C30H40O5/c1-18(14-20-15-26(33-5)28(35-7)27(16-20)34-6)29(31)30(3)13-12-25-23(19(30)2)10-8-21-17-22(32-4)9-11-24(21)25/h9,11,14-17,19,23,25,29,31H,8,10,12-13H2,1-7H3/b18-14+/t19?,23?,25?,29-,30-/m0/s1 |
| InChIKey | SCKHAQXOBGUUPZ-SRHBOWMPSA-N |
| XLogP | 6.27 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |