C28H35NO7S — CID 91227252
[(13S,17S)-17-hydroxy-13-methyl-16-[(3,4,5-trimethoxyphenyl)methylidene]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 91227252) has the molecular formula C28H35NO7S and a molecular weight of 529.66 g/mol. Its IUPAC name is [(13S,17S)-17-hydroxy-13-methyl-16-[(3,4,5-trimethoxyphenyl)methylidene]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(13S,17S)-17-hydroxy-13-methyl-16-[(3,4,5-trimethoxyphenyl)methylidene]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 91227252 |
| Molecular Formula | C28H35NO7S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | [(13S,17S)-17-hydroxy-13-methyl-16-[(3,4,5-trimethoxyphenyl)methylidene]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | COc1cc(C=C2CC3C4CCc5cc(OS(N)(=O)=O)ccc5C4CC[C@]3(C)[C@H]2O)cc(OC)c1OC |
| InChI | InChI=1S/C28H35NO7S/c1-28-10-9-21-20-8-6-19(36-37(29,31)32)14-17(20)5-7-22(21)23(28)15-18(27(28)30)11-16-12-24(33-2)26(35-4)25(13-16)34-3/h6,8,11-14,21-23,27,30H,5,7,9-10,15H2,1-4H3,(H2,29,31,32)/t21?,22?,23?,27-,28-/m0/s1 |
| InChIKey | NGMOSIQFWIUINX-NJSQIBGVSA-N |
| XLogP | 4.21 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |