C27H30N2O3 — CID 123539394
(8R,9S,13S,14S,17S)-16-[(3-carbamoylphenyl)methylidene]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 123539394) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-16-[(3-carbamoylphenyl)methylidene]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8R,9S,13S,14S,17S)-16-[(3-carbamoylphenyl)methylidene]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 123539394 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (8R,9S,13S,14S,17S)-16-[(3-carbamoylphenyl)methylidene]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(C(N)=O)cc4CC[C@H]3[C@@H]1CC(=Cc1cccc(C(N)=O)c1)[C@@H]2O |
| InChI | InChI=1S/C27H30N2O3/c1-27-10-9-21-20-7-6-18(26(29)32)13-16(20)5-8-22(21)23(27)14-19(24(27)30)12-15-3-2-4-17(11-15)25(28)31/h2-4,6-7,11-13,21-24,30H,5,8-10,14H2,1H3,(H2,28,31)(H2,29,32)/t21-,22-,23+,24+,27+/m1/s1 |
| InChIKey | PEKPJLRSYQHDFZ-TXDQRGGKSA-N |
| XLogP | 3.79 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |