C25H28BNO4 — CID 90073439
[(2E,11aS)-2-[(3-carbamoylphenyl)methylidene]-11a-methyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][1]benzofuran-7-yl]boronic acid (PubChem CID 90073439) has the molecular formula C25H28BNO4 and a molecular weight of 417.31 g/mol. Its IUPAC name is [(2E,11aS)-2-[(3-carbamoylphenyl)methylidene]-11a-methyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][1]benzofuran-7-yl]boronic acid.
| Compound Name | [(2E,11aS)-2-[(3-carbamoylphenyl)methylidene]-11a-methyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][1]benzofuran-7-yl]boronic acid |
|---|---|
| PubChem CID | 90073439 |
| Molecular Formula | C25H28BNO4 |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [(2E,11aS)-2-[(3-carbamoylphenyl)methylidene]-11a-methyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][1]benzofuran-7-yl]boronic acid |
| SMILES | C[C@]12CCC3c4ccc(B(O)O)cc4CCC3C1C/C(=C\c1cccc(C(N)=O)c1)O2 |
| InChI | InChI=1S/C25H28BNO4/c1-25-10-9-21-20-8-6-18(26(29)30)13-16(20)5-7-22(21)23(25)14-19(31-25)12-15-3-2-4-17(11-15)24(27)28/h2-4,6,8,11-13,21-23,29-30H,5,7,9-10,14H2,1H3,(H2,27,28)/b19-12+/t21?,22?,23?,25-/m0/s1 |
| InChIKey | BAPXCVGSXKSATM-FZTDONRASA-N |
| XLogP | 2.74 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|