C34H37NO3 — CID 90073046
3-[(E)-[(11aS)-11a-methyl-7-(2-phenylmethoxyethyl)-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][1]benzofuran-2-ylidene]methyl]benzamide (PubChem CID 90073046) has the molecular formula C34H37NO3 and a molecular weight of 507.67 g/mol. Its IUPAC name is 3-[(E)-[(11aS)-11a-methyl-7-(2-phenylmethoxyethyl)-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][1]benzofuran-2-ylidene]methyl]benzamide.
| Compound Name | 3-[(E)-[(11aS)-11a-methyl-7-(2-phenylmethoxyethyl)-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][1]benzofuran-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 90073046 |
| Molecular Formula | C34H37NO3 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 3-[(E)-[(11aS)-11a-methyl-7-(2-phenylmethoxyethyl)-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][1]benzofuran-2-ylidene]methyl]benzamide |
| SMILES | C[C@]12CCC3c4ccc(CCOCc5ccccc5)cc4CCC3C1C/C(=C\c1cccc(C(N)=O)c1)O2 |
| InChI | InChI=1S/C34H37NO3/c1-34-16-14-30-29-12-10-23(15-17-37-22-24-6-3-2-4-7-24)18-26(29)11-13-31(30)32(34)21-28(38-34)20-25-8-5-9-27(19-25)33(35)36/h2-10,12,18-20,30-32H,11,13-17,21-22H2,1H3,(H2,35,36)/b28-20+/t30?,31?,32?,34-/m0/s1 |
| InChIKey | PYRXJVUPJODQCK-DINDFDTPSA-N |
| XLogP | 6.82 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|