C31H38O6 — CID 21018230
diethyl 2-[(3S,11aS)-11a-methyl-7-phenylmethoxy-3,3a,3b,4,5,9b,10,11-octahydro-2H-naphtho[2,1-e][1]benzofuran-3-yl]propanedioate (PubChem CID 21018230) has the molecular formula C31H38O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is diethyl 2-[(3S,11aS)-11a-methyl-7-phenylmethoxy-3,3a,3b,4,5,9b,10,11-octahydro-2H-naphtho[2,1-e][1]benzofuran-3-yl]propanedioate.
| Compound Name | diethyl 2-[(3S,11aS)-11a-methyl-7-phenylmethoxy-3,3a,3b,4,5,9b,10,11-octahydro-2H-naphtho[2,1-e][1]benzofuran-3-yl]propanedioate |
|---|---|
| PubChem CID | 21018230 |
| Molecular Formula | C31H38O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | diethyl 2-[(3S,11aS)-11a-methyl-7-phenylmethoxy-3,3a,3b,4,5,9b,10,11-octahydro-2H-naphtho[2,1-e][1]benzofuran-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1CO[C@@]2(C)CCC3c4ccc(OCc5ccccc5)cc4CCC3C12 |
| InChI | InChI=1S/C31H38O6/c1-4-34-29(32)27(30(33)35-5-2)26-19-37-31(3)16-15-24-23-14-12-22(36-18-20-9-7-6-8-10-20)17-21(23)11-13-25(24)28(26)31/h6-10,12,14,17,24-28H,4-5,11,13,15-16,18-19H2,1-3H3/t24?,25?,26?,28?,31-/m0/s1 |
| InChIKey | MVFLBTMHQHMZQA-QSQZSWGSSA-N |
| XLogP | 5.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|