C29H37NO2 — CID 70811448
3-[[(8R,9S,13S,14S,16R,17S)-17-hydroxy-13-methyl-3-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide (PubChem CID 70811448) has the molecular formula C29H37NO2 and a molecular weight of 431.62 g/mol. Its IUPAC name is 3-[[(8R,9S,13S,14S,16R,17S)-17-hydroxy-13-methyl-3-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide.
| Compound Name | 3-[[(8R,9S,13S,14S,16R,17S)-17-hydroxy-13-methyl-3-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide |
|---|---|
| PubChem CID | 70811448 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 3-[[(8R,9S,13S,14S,16R,17S)-17-hydroxy-13-methyl-3-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide |
| SMILES | CCCc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)[C@@H](Cc3cccc(C(N)=O)c3)C[C@@H]12 |
| InChI | InChI=1S/C29H37NO2/c1-3-5-18-8-10-23-20(14-18)9-11-25-24(23)12-13-29(2)26(25)17-22(27(29)31)16-19-6-4-7-21(15-19)28(30)32/h4,6-8,10,14-15,22,24-27,31H,3,5,9,11-13,16-17H2,1-2H3,(H2,30,32)/t22-,24+,25+,26-,27-,29-/m0/s1 |
| InChIKey | KZFFGFSHKVEMNT-XXOXGGEOSA-N |
| XLogP | 5.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |