C27H34N2O2 — CID 90073057
3-[[(13S,16R,17S)-17-hydroxy-13-methyl-3-(methylamino)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide (PubChem CID 90073057) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 3-[[(13S,16R,17S)-17-hydroxy-13-methyl-3-(methylamino)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide.
| Compound Name | 3-[[(13S,16R,17S)-17-hydroxy-13-methyl-3-(methylamino)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide |
|---|---|
| PubChem CID | 90073057 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 3-[[(13S,16R,17S)-17-hydroxy-13-methyl-3-(methylamino)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide |
| SMILES | CNc1ccc2c(c1)CCC1C2CC[C@@]2(C)C1C[C@H](Cc1cccc(C(N)=O)c1)[C@@H]2O |
| InChI | InChI=1S/C27H34N2O2/c1-27-11-10-22-21-9-7-20(29-2)14-17(21)6-8-23(22)24(27)15-19(25(27)30)13-16-4-3-5-18(12-16)26(28)31/h3-5,7,9,12,14,19,22-25,29-30H,6,8,10-11,13,15H2,1-2H3,(H2,28,31)/t19-,22?,23?,24?,25-,27-/m0/s1 |
| InChIKey | LRYRBKHWINWRRY-SLBJSBGYSA-N |
| XLogP | 4.51 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |