C22H29NO2 — CID 142945010
(13S,16E,17S)-13-methyl-16-(2-methylpropylidene)-3-nitroso-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 142945010) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (13S,16E,17S)-13-methyl-16-(2-methylpropylidene)-3-nitroso-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (13S,16E,17S)-13-methyl-16-(2-methylpropylidene)-3-nitroso-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 142945010 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (13S,16E,17S)-13-methyl-16-(2-methylpropylidene)-3-nitroso-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC(C)/C=C1\CC2C3CCc4cc(N=O)ccc4C3CC[C@]2(C)[C@H]1O |
| InChI | InChI=1S/C22H29NO2/c1-13(2)10-15-12-20-19-6-4-14-11-16(23-25)5-7-17(14)18(19)8-9-22(20,3)21(15)24/h5,7,10-11,13,18-21,24H,4,6,8-9,12H2,1-3H3/b15-10+/t18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | GOMCMKFRYXPOTF-QHMVYYSYSA-N |
| XLogP | 5.49 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|