C23H32N2O — CID 142945083
(9S)-7-(2-methoxyethyl)-9,16-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,13(18),14,16-pentaene;molecular hydrogen (PubChem CID 142945083) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is (9S)-7-(2-methoxyethyl)-9,16-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,13(18),14,16-pentaene;molecular hydrogen.
| Compound Name | (9S)-7-(2-methoxyethyl)-9,16-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,13(18),14,16-pentaene;molecular hydrogen |
|---|---|
| PubChem CID | 142945083 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | (9S)-7-(2-methoxyethyl)-9,16-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,13(18),14,16-pentaene;molecular hydrogen |
| SMILES | COCCn1ncc2c1[C@@]1(C)CCC3c4ccc(C)cc4CCC3C1C2.[H][H] |
| InChI | InChI=1S/C23H30N2O.H2/c1-15-4-6-18-16(12-15)5-7-20-19(18)8-9-23(2)21(20)13-17-14-24-25(22(17)23)10-11-26-3;/h4,6,12,14,19-21H,5,7-11,13H2,1-3H3;1H/t19?,20?,21?,23-;/m0./s1 |
| InChIKey | XKKFCRXJMWVPHJ-WOOFAIMYSA-N |
| XLogP | 4.65 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |