C19H20FNO — CID 71032181
(13S)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile (PubChem CID 71032181) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is (13S)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile.
| Compound Name | (13S)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 71032181 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (13S)-4-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile |
| SMILES | C[C@]12CCC3c4ccc(C#N)c(F)c4CCC3C1CCC2=O |
| InChI | InChI=1S/C19H20FNO/c1-19-9-8-13-12-3-2-11(10-21)18(20)15(12)5-4-14(13)16(19)6-7-17(19)22/h2-3,13-14,16H,4-9H2,1H3/t13?,14?,16?,19-/m0/s1 |
| InChIKey | AROAPVQBXUBMFX-RYCRIANLSA-N |
| XLogP | 4.12 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |