C21H30O2Si — CID 23265589
(8R,9S,13S,14S)-3-hydroxy-13-methyl-4-trimethylsilyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 23265589) has the molecular formula C21H30O2Si and a molecular weight of 342.56 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-hydroxy-13-methyl-4-trimethylsilyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-4-trimethylsilyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 23265589 |
| Molecular Formula | C21H30O2Si |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-4-trimethylsilyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)c([Si](C)(C)C)c4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C21H30O2Si/c1-21-12-11-14-13-7-9-18(22)20(24(2,3)4)16(13)6-5-15(14)17(21)8-10-19(21)23/h7,9,14-15,17,22H,5-6,8,10-12H2,1-4H3/t14-,15-,17+,21+/m1/s1 |
| InChIKey | ZSKXFIZMXFQIGG-WYSJICDVSA-N |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|