C22H27NO4 — CID 155274848
ethyl 2-[(8R,13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-yl]-2-iminoacetate (PubChem CID 155274848) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is ethyl 2-[(8R,13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-yl]-2-iminoacetate.
| Compound Name | ethyl 2-[(8R,13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-yl]-2-iminoacetate |
|---|---|
| PubChem CID | 155274848 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | ethyl 2-[(8R,13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-4-yl]-2-iminoacetate |
| SMILES | [H]/N=C(\C(=O)OCC)c1c(O)ccc2c1CC[C@@H]1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C22H27NO4/c1-3-27-21(26)20(23)19-15-5-4-14-13(12(15)6-8-17(19)24)10-11-22(2)16(14)7-9-18(22)25/h6,8,13-14,16,23-24H,3-5,7,9-11H2,1-2H3/b23-20-/t13?,14-,16?,22+/m1/s1 |
| InChIKey | IVLVJYGGVQZWHH-BOMURYQOSA-N |
| XLogP | 3.75 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|