C23H25Cl3O3 — CID 143598265
trichloromethyl 13-methyl-17-oxo-4-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 143598265) has the molecular formula C23H25Cl3O3 and a molecular weight of 455.81 g/mol. Its IUPAC name is trichloromethyl 13-methyl-17-oxo-4-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | trichloromethyl 13-methyl-17-oxo-4-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 143598265 |
| Molecular Formula | C23H25Cl3O3 |
| Molecular Weight | 455.81 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | trichloromethyl 13-methyl-17-oxo-4-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | C=CCc1c(C(=O)OC(Cl)(Cl)Cl)ccc2c1CCC1C2CCC2(C)C(=O)CCC12 |
| InChI | InChI=1S/C23H25Cl3O3/c1-3-4-13-14-5-7-17-16(11-12-22(2)19(17)9-10-20(22)27)15(14)6-8-18(13)21(28)29-23(24,25)26/h3,6,8,16-17,19H,1,4-5,7,9-12H2,2H3 |
| InChIKey | WXJXRUIDIYSVHF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.81 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|