C24H38O3Si2 — CID 634767
13-methyl-3,4-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 634767) has the molecular formula C24H38O3Si2 and a molecular weight of 430.74 g/mol. Its IUPAC name is 13-methyl-3,4-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | 13-methyl-3,4-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 634767 |
| Molecular Formula | C24H38O3Si2 |
| Molecular Weight | 430.74 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 13-methyl-3,4-bis(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC12CCC3c4ccc(O[Si](C)(C)C)c(O[Si](C)(C)C)c4CCC3C1CCC2=O |
| InChI | InChI=1S/C24H38O3Si2/c1-24-15-14-17-16-10-12-21(26-28(2,3)4)23(27-29(5,6)7)19(16)9-8-18(17)20(24)11-13-22(24)25/h10,12,17-18,20H,8-9,11,13-15H2,1-7H3 |
| InChIKey | BTZHTEFDILXVSM-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.74 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|