C21H25N2OP — CID 118889279
(13S)-13-methyl-17-oxo-3-(1-phosphanylethylideneamino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-4-carbonitrile (PubChem CID 118889279) has the molecular formula C21H25N2OP and a molecular weight of 352.42 g/mol. Its IUPAC name is (13S)-13-methyl-17-oxo-3-(1-phosphanylethylideneamino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-4-carbonitrile.
| Compound Name | (13S)-13-methyl-17-oxo-3-(1-phosphanylethylideneamino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-4-carbonitrile |
|---|---|
| PubChem CID | 118889279 |
| Molecular Formula | C21H25N2OP |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (13S)-13-methyl-17-oxo-3-(1-phosphanylethylideneamino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-4-carbonitrile |
| SMILES | C/C(P)=N\c1ccc2c(c1C#N)CCC1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C21H25N2OP/c1-12(25)23-19-7-5-13-14(17(19)11-22)3-4-16-15(13)9-10-21(2)18(16)6-8-20(21)24/h5,7,15-16,18H,3-4,6,8-10,25H2,1-2H3/b23-12+/t15?,16?,18?,21-/m0/s1 |
| InChIKey | SESTUTGHSXNEBV-IMUDOBEKSA-N |
| XLogP | 4.91 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|