C21H25NO3S — CID 58665738
(18S)-18-methyl-6-methylsulfonyl-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-2(10),3,5(9),7-tetraen-17-one (PubChem CID 58665738) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is (18S)-18-methyl-6-methylsulfonyl-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-2(10),3,5(9),7-tetraen-17-one.
| Compound Name | (18S)-18-methyl-6-methylsulfonyl-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-2(10),3,5(9),7-tetraen-17-one |
|---|---|
| PubChem CID | 58665738 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (18S)-18-methyl-6-methylsulfonyl-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-2(10),3,5(9),7-tetraen-17-one |
| SMILES | C[C@]12CCC3c4ccc5c(ccn5S(C)(=O)=O)c4CCC3C1CCC2=O |
| InChI | InChI=1S/C21H25NO3S/c1-21-11-9-15-13-5-7-19-17(10-12-22(19)26(2,24)25)14(13)3-4-16(15)18(21)6-8-20(21)23/h5,7,10,12,15-16,18H,3-4,6,8-9,11H2,1-2H3/t15?,16?,18?,21-/m0/s1 |
| InChIKey | WRKABDVOWWKEHY-MGGPMZQCSA-N |
| XLogP | 3.87 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |