C28H32O3 — CID 177452506
(8R,9S,13R,14S)-3-methoxy-4-[(E)-2-(4-methoxyphenyl)ethenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 177452506) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is (8R,9S,13R,14S)-3-methoxy-4-[(E)-2-(4-methoxyphenyl)ethenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13R,14S)-3-methoxy-4-[(E)-2-(4-methoxyphenyl)ethenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 177452506 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (8R,9S,13R,14S)-3-methoxy-4-[(E)-2-(4-methoxyphenyl)ethenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | COc1ccc(/C=C/c2c(OC)ccc3c2CC[C@@H]2[C@@H]3CC[C@@]3(C)C(=O)CC[C@@H]23)cc1 |
| InChI | InChI=1S/C28H32O3/c1-28-17-16-22-20-12-14-26(31-3)24(9-6-18-4-7-19(30-2)8-5-18)21(20)10-11-23(22)25(28)13-15-27(28)29/h4-9,12,14,22-23,25H,10-11,13,15-17H2,1-3H3/b9-6+/t22-,23-,25+,28-/m1/s1 |
| InChIKey | VNKGRZSHCLAWIT-ZKQVFTJJSA-N |
| XLogP | 6.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|