C19H23F3O2 — CID 135019011
(13S,17S)-13-methyl-4-(trifluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 135019011) has the molecular formula C19H23F3O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is (13S,17S)-13-methyl-4-(trifluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (13S,17S)-13-methyl-4-(trifluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 135019011 |
| Molecular Formula | C19H23F3O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (13S,17S)-13-methyl-4-(trifluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CCC3c4ccc(O)c(C(F)(F)F)c4CCC3C1CC[C@@H]2O |
| InChI | InChI=1S/C19H23F3O2/c1-18-9-8-11-10-4-6-15(23)17(19(20,21)22)13(10)3-2-12(11)14(18)5-7-16(18)24/h4,6,11-12,14,16,23-24H,2-3,5,7-9H2,1H3/t11?,12?,14?,16-,18-/m0/s1 |
| InChIKey | VSPVUEFTRFZCTI-JNYWYMJGSA-N |
| XLogP | 4.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |