C20H27BrO3 — CID 14334375
(8R,9S,13S,14S,17S)-4-bromo-3-(2-hydroxyethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 14334375) has the molecular formula C20H27BrO3 and a molecular weight of 395.34 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-4-bromo-3-(2-hydroxyethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-4-bromo-3-(2-hydroxyethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 14334375 |
| Molecular Formula | C20H27BrO3 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (8R,9S,13S,14S,17S)-4-bromo-3-(2-hydroxyethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCO)c(Br)c4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C20H27BrO3/c1-20-9-8-13-12-4-6-17(24-11-10-22)19(21)15(12)3-2-14(13)16(20)5-7-18(20)23/h4,6,13-14,16,18,22-23H,2-3,5,7-11H2,1H3/t13-,14-,16+,18+,20+/m1/s1 |
| InChIKey | DCEIUIHLGHWYEI-XQRBHQRSSA-N |
| XLogP | 4.04 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |