C21H31NO — CID 70935115
O-[[(6R,8S,9S,13R,14S)-3,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]methyl]hydroxylamine (PubChem CID 70935115) has the molecular formula C21H31NO and a molecular weight of 313.48 g/mol. Its IUPAC name is O-[[(6R,8S,9S,13R,14S)-3,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]methyl]hydroxylamine.
| Compound Name | O-[[(6R,8S,9S,13R,14S)-3,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 70935115 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | O-[[(6R,8S,9S,13R,14S)-3,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]methyl]hydroxylamine |
| SMILES | Cc1ccc2c(c1)[C@H](CON)C[C@@H]1[C@@H]2CC[C@]2(C)C(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H31NO/c1-13-4-6-16-17-8-9-21(3)14(2)5-7-20(21)19(17)11-15(12-23-22)18(16)10-13/h4,6,10,14-15,17,19-20H,5,7-9,11-12,22H2,1-3H3/t14?,15-,17+,19+,20-,21+/m0/s1 |
| InChIKey | VQVJYAIIVMLQNB-ODVVGZMISA-N |
| XLogP | 4.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|