C21H31IOY — CID 58036839
[(13R,17S)-3-methoxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]-methyl-λ3-iodane;yttrium (PubChem CID 58036839) has the molecular formula C21H31IOY and a molecular weight of 515.29 g/mol. Its IUPAC name is [(13R,17S)-3-methoxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]-methyl-λ3-iodane;yttrium.
| Compound Name | [(13R,17S)-3-methoxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]-methyl-λ3-iodane;yttrium |
|---|---|
| PubChem CID | 58036839 |
| Molecular Formula | C21H31IOY |
| Molecular Weight | 515.29 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | [(13R,17S)-3-methoxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-yl]-methyl-λ3-iodane;yttrium |
| SMILES | COc1ccc2c(c1[IH]C)CCC1C2CC[C@@]2(C)C1CC[C@@H]2C.[Y] |
| InChI | InChI=1S/C21H31IO.Y/c1-13-5-9-18-16-6-7-17-14(15(16)11-12-21(13,18)2)8-10-19(23-4)20(17)22-3;/h8,10,13,15-16,18,22H,5-7,9,11-12H2,1-4H3;/t13-,15?,16?,18?,21+;/m0./s1 |
| InChIKey | ROWMPVNRJVFBQF-TZTZQLEOSA-N |
| XLogP | 5.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|