C32H50O7 — CID 90287771
tert-butyl 2-[4-[(7R,8R,9S,13S,14S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]acetate (PubChem CID 90287771) has the molecular formula C32H50O7 and a molecular weight of 546.75 g/mol. Its IUPAC name is tert-butyl 2-[4-[(7R,8R,9S,13S,14S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]acetate.
| Compound Name | tert-butyl 2-[4-[(7R,8R,9S,13S,14S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]acetate |
|---|---|
| PubChem CID | 90287771 |
| Molecular Formula | C32H50O7 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | tert-butyl 2-[4-[(7R,8R,9S,13S,14S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]acetate |
| SMILES | COCOc1ccc2c(c1)C[C@@H](CCCCOCC(=O)OC(C)(C)C)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OCOC)CC[C@@H]12 |
| InChI | InChI=1S/C32H50O7/c1-31(2,3)39-29(33)19-36-16-8-7-9-22-17-23-18-24(37-20-34-5)10-11-25(23)26-14-15-32(4)27(30(22)26)12-13-28(32)38-21-35-6/h10-11,18,22,26-28,30H,7-9,12-17,19-21H2,1-6H3/t22-,26-,27+,28+,30-,32+/m1/s1 |
| InChIKey | CUUGCPAJWRTBCY-SKWWSWCXSA-N |
| XLogP | 6.27 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|