C32H52O6 — CID 90287772
(7R,8R,9S,13S,14S,17S)-17-methoxy-3-(methoxymethoxy)-13-methyl-7-[4-[2-(2-propoxyethoxy)ethoxy]butyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 90287772) has the molecular formula C32H52O6 and a molecular weight of 532.76 g/mol. Its IUPAC name is (7R,8R,9S,13S,14S,17S)-17-methoxy-3-(methoxymethoxy)-13-methyl-7-[4-[2-(2-propoxyethoxy)ethoxy]butyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (7R,8R,9S,13S,14S,17S)-17-methoxy-3-(methoxymethoxy)-13-methyl-7-[4-[2-(2-propoxyethoxy)ethoxy]butyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 90287772 |
| Molecular Formula | C32H52O6 |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | (7R,8R,9S,13S,14S,17S)-17-methoxy-3-(methoxymethoxy)-13-methyl-7-[4-[2-(2-propoxyethoxy)ethoxy]butyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CCCOCCOCCOCCCC[C@@H]1Cc2cc(OCOC)ccc2[C@H]2CC[C@]3(C)[C@@H](OC)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C32H52O6/c1-5-15-35-17-19-37-20-18-36-16-7-6-8-24-21-25-22-26(38-23-33-3)9-10-27(25)28-13-14-32(2)29(31(24)28)11-12-30(32)34-4/h9-10,22,24,28-31H,5-8,11-21,23H2,1-4H3/t24-,28-,29+,30+,31-,32+/m1/s1 |
| InChIKey | IKMQEXQSQYYCGD-YVAHLQCFSA-N |
| XLogP | 6.40 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|