C35H56O7 — CID 123997854
tert-butyl 2-[2-[2-[4-[3-(methoxymethoxy)-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]ethoxy]ethoxy]acetate (PubChem CID 123997854) has the molecular formula C35H56O7 and a molecular weight of 588.83 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[4-[3-(methoxymethoxy)-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[4-[3-(methoxymethoxy)-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 123997854 |
| Molecular Formula | C35H56O7 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | tert-butyl 2-[2-[2-[4-[3-(methoxymethoxy)-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]ethoxy]ethoxy]acetate |
| SMILES | COCOc1ccc2c(c1)CC(CCCCOCCOCCOCC(=O)OC(C)(C)C)C1C2CCC2(C)C(C)CCC12 |
| InChI | InChI=1S/C35H56O7/c1-25-10-13-31-33-26(9-7-8-16-38-17-18-39-19-20-40-23-32(36)42-34(2,3)4)21-27-22-28(41-24-37-6)11-12-29(27)30(33)14-15-35(25,31)5/h11-12,22,25-26,30-31,33H,7-10,13-21,23-24H2,1-6H3 |
| InChIKey | HXQVFVKQRJQRTQ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|