C29H44FNO4S — CID 157212822
[(7R,8R,9S,13S,14S,17S)-7-[3-(4-fluorobutylsulfinyl)propyl]-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-amino-2-methylpropanoate (PubChem CID 157212822) has the molecular formula C29H44FNO4S and a molecular weight of 521.74 g/mol. Its IUPAC name is [(7R,8R,9S,13S,14S,17S)-7-[3-(4-fluorobutylsulfinyl)propyl]-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-amino-2-methylpropanoate.
| Compound Name | [(7R,8R,9S,13S,14S,17S)-7-[3-(4-fluorobutylsulfinyl)propyl]-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 157212822 |
| Molecular Formula | C29H44FNO4S |
| Molecular Weight | 521.74 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | [(7R,8R,9S,13S,14S,17S)-7-[3-(4-fluorobutylsulfinyl)propyl]-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-amino-2-methylpropanoate |
| SMILES | CC(C)(N)C(=O)Oc1ccc2c(c1)C[C@@H](CCCS(=O)CCCCF)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C29H44FNO4S/c1-28(2,31)27(33)35-21-8-9-22-20(18-21)17-19(7-6-16-36(34)15-5-4-14-30)26-23(22)12-13-29(3)24(26)10-11-25(29)32/h8-9,18-19,23-26,32H,4-7,10-17,31H2,1-3H3/t19-,23-,24+,25+,26-,29+,36?/m1/s1 |
| InChIKey | OSFLOULAUWJKGZ-PMEZSBMCSA-N |
| XLogP | 5.05 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.74 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|