C20H30O7 — CID 11199912
methyl (1'S,4'S,5'R)-5'-[2-(methoxymethoxy)ethyl]-4'-methyl-7'-prop-2-enoxyspiro[1,3-dioxolane-2,2'-bicyclo[3.2.1]oct-6-ene]-6'-carboxylate (PubChem CID 11199912) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is methyl (1'S,4'S,5'R)-5'-[2-(methoxymethoxy)ethyl]-4'-methyl-7'-prop-2-enoxyspiro[1,3-dioxolane-2,2'-bicyclo[3.2.1]oct-6-ene]-6'-carboxylate.
| Compound Name | methyl (1'S,4'S,5'R)-5'-[2-(methoxymethoxy)ethyl]-4'-methyl-7'-prop-2-enoxyspiro[1,3-dioxolane-2,2'-bicyclo[3.2.1]oct-6-ene]-6'-carboxylate |
|---|---|
| PubChem CID | 11199912 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | methyl (1'S,4'S,5'R)-5'-[2-(methoxymethoxy)ethyl]-4'-methyl-7'-prop-2-enoxyspiro[1,3-dioxolane-2,2'-bicyclo[3.2.1]oct-6-ene]-6'-carboxylate |
| SMILES | C=CCOC1=C(C(=O)OC)[C@@]2(CCOCOC)C[C@@H]1C1(C[C@@H]2C)OCCO1 |
| InChI | InChI=1S/C20H30O7/c1-5-7-25-17-15-12-19(6-8-24-13-22-3,16(17)18(21)23-4)14(2)11-20(15)26-9-10-27-20/h5,14-15H,1,6-13H2,2-4H3/t14-,15-,19-/m0/s1 |
| InChIKey | SAXXCVSNMOFSTN-DOXZYTNZSA-N |
| XLogP | 2.42 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|