C18H26O7 — CID 102053044
methyl (2S,3S)-3-hydroxy-5-methoxy-2-[3-(methoxymethoxy)propyl]-2-methyl-3,4-dihydrochromene-7-carboxylate (PubChem CID 102053044) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is methyl (2S,3S)-3-hydroxy-5-methoxy-2-[3-(methoxymethoxy)propyl]-2-methyl-3,4-dihydrochromene-7-carboxylate.
| Compound Name | methyl (2S,3S)-3-hydroxy-5-methoxy-2-[3-(methoxymethoxy)propyl]-2-methyl-3,4-dihydrochromene-7-carboxylate |
|---|---|
| PubChem CID | 102053044 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | methyl (2S,3S)-3-hydroxy-5-methoxy-2-[3-(methoxymethoxy)propyl]-2-methyl-3,4-dihydrochromene-7-carboxylate |
| SMILES | COCOCCC[C@]1(C)Oc2cc(C(=O)OC)cc(OC)c2C[C@@H]1O |
| InChI | InChI=1S/C18H26O7/c1-18(6-5-7-24-11-21-2)16(19)10-13-14(22-3)8-12(17(20)23-4)9-15(13)25-18/h8-9,16,19H,5-7,10-11H2,1-4H3/t16-,18-/m0/s1 |
| InChIKey | LOOBVWQBBXWPCY-WMZOPIPTSA-N |
| XLogP | 1.94 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|