C18H24O5 — CID 155294768
methyl (2R,3R)-3,8-dihydroxy-2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-6-carboxylate (PubChem CID 155294768) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl (2R,3R)-3,8-dihydroxy-2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-6-carboxylate.
| Compound Name | methyl (2R,3R)-3,8-dihydroxy-2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-6-carboxylate |
|---|---|
| PubChem CID | 155294768 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | methyl (2R,3R)-3,8-dihydroxy-2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromene-6-carboxylate |
| SMILES | COC(=O)c1cc(O)c2c(c1)C[C@@H](O)[C@@](C)(CCC=C(C)C)O2 |
| InChI | InChI=1S/C18H24O5/c1-11(2)6-5-7-18(3)15(20)10-12-8-13(17(21)22-4)9-14(19)16(12)23-18/h6,8-9,15,19-20H,5,7,10H2,1-4H3/t15-,18-/m1/s1 |
| InChIKey | SCVYCOQQSQAFIY-CRAIPNDOSA-N |
| XLogP | 2.98 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|