C31H37NO6 — CID 76578153
4-[2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-3-methylbenzoic acid (PubChem CID 76578153) has the molecular formula C31H37NO6 and a molecular weight of 519.64 g/mol. Its IUPAC name is 4-[2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-3-methylbenzoic acid.
| Compound Name | 4-[2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 76578153 |
| Molecular Formula | C31H37NO6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 4-[2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-3-methylbenzoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC1(C)Oc2c(c(O)cc3c2CN(c2ccc(C(=O)O)cc2C)C3=O)CC1O |
| InChI | InChI=1S/C31H37NO6/c1-18(2)8-6-9-19(3)10-7-13-31(5)27(34)16-23-26(33)15-22-24(28(23)38-31)17-32(29(22)35)25-12-11-21(30(36)37)14-20(25)4/h8,10-12,14-15,27,33-34H,6-7,9,13,16-17H2,1-5H3,(H,36,37) |
| InChIKey | XTQVAPCKVOPKNF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|