C30H43NO6 — CID 67949161
(2R)-6-[(2S,3S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-2-methylhexanoic acid (PubChem CID 67949161) has the molecular formula C30H43NO6 and a molecular weight of 513.68 g/mol. Its IUPAC name is (2R)-6-[(2S,3S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-2-methylhexanoic acid.
| Compound Name | (2R)-6-[(2S,3S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-2-methylhexanoic acid |
|---|---|
| PubChem CID | 67949161 |
| Molecular Formula | C30H43NO6 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | (2R)-6-[(2S,3S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-2-methylhexanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@]1(C)Oc2c(c(O)cc3c2CN(CCCC[C@@H](C)C(=O)O)C3=O)C[C@@H]1O |
| InChI | InChI=1S/C30H43NO6/c1-19(2)10-8-11-20(3)12-9-14-30(5)26(33)17-23-25(32)16-22-24(27(23)37-30)18-31(28(22)34)15-7-6-13-21(4)29(35)36/h10,12,16,21,26,32-33H,6-9,11,13-15,17-18H2,1-5H3,(H,35,36)/b20-12+/t21-,26+,30+/m1/s1 |
| InChIKey | TUHHJEAYCKAQLG-OWNKJTOCSA-N |
| XLogP | 5.77 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|