C27H37NO6 — CID 162800816
2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-8-(4-hydroxy-2-oxobutyl)-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one (PubChem CID 162800816) has the molecular formula C27H37NO6 and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-8-(4-hydroxy-2-oxobutyl)-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one.
| Compound Name | 2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-8-(4-hydroxy-2-oxobutyl)-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one |
|---|---|
| PubChem CID | 162800816 |
| Molecular Formula | C27H37NO6 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-8-(4-hydroxy-2-oxobutyl)-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one |
| SMILES | CC(C)=CCCC(C)=CCCC1(C)Oc2c(c(O)cc3c2CN(CC(=O)CCO)C3=O)CC1O |
| InChI | InChI=1S/C27H37NO6/c1-17(2)7-5-8-18(3)9-6-11-27(4)24(32)14-21-23(31)13-20-22(25(21)34-27)16-28(26(20)33)15-19(30)10-12-29/h7,9,13,24,29,31-32H,5-6,8,10-12,14-16H2,1-4H3 |
| InChIKey | RDFLFCUCUBDOBI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|