C30H35NO6 — CID 50898406
4-[(2S,3S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]benzoic acid (PubChem CID 50898406) has the molecular formula C30H35NO6 and a molecular weight of 505.61 g/mol. Its IUPAC name is 4-[(2S,3S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]benzoic acid.
| Compound Name | 4-[(2S,3S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]benzoic acid |
|---|---|
| PubChem CID | 50898406 |
| Molecular Formula | C30H35NO6 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 4-[(2S,3S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]benzoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@]1(C)Oc2c(c(O)cc3c2CN(c2ccc(C(=O)O)cc2)C3=O)C[C@@H]1O |
| InChI | InChI=1S/C30H35NO6/c1-18(2)7-5-8-19(3)9-6-14-30(4)26(33)16-23-25(32)15-22-24(27(23)37-30)17-31(28(22)34)21-12-10-20(11-13-21)29(35)36/h7,9-13,15,26,32-33H,5-6,8,14,16-17H2,1-4H3,(H,35,36)/b19-9+/t26-,30-/m0/s1 |
| InChIKey | YYTFSOJROGXCJO-CSDPAROFSA-N |
| XLogP | 5.78 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|