C31H41NO8 — CID 143547766
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-8-[4-hydroxy-2-(trioxidanyl)phenyl]-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one;ethane (PubChem CID 143547766) has the molecular formula C31H41NO8 and a molecular weight of 555.67 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-8-[4-hydroxy-2-(trioxidanyl)phenyl]-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one;ethane.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-8-[4-hydroxy-2-(trioxidanyl)phenyl]-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one;ethane |
|---|---|
| PubChem CID | 143547766 |
| Molecular Formula | C31H41NO8 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-8-[4-hydroxy-2-(trioxidanyl)phenyl]-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one;ethane |
| SMILES | CC.CC(C)=CCC/C(C)=C/CCC1(C)Oc2c(c(O)cc3c2CN(c2ccc(O)cc2OOO)C3=O)CC1O |
| InChI | InChI=1S/C29H35NO8.C2H6/c1-17(2)7-5-8-18(3)9-6-12-29(4)26(33)15-21-24(32)14-20-22(27(21)36-29)16-30(28(20)34)23-11-10-19(31)13-25(23)37-38-35;1-2/h7,9-11,13-14,26,31-33,35H,5-6,8,12,15-16H2,1-4H3;1-2H3/b18-9+; |
| InChIKey | GYDUJPYNUOPVJO-WUBZALIBSA-N |
| XLogP | 6.60 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|